C12H18Cl2N2O2 — CID 141267432
3,4-dichloropyridine-2-carboxylate;triethylazanium (PubChem CID 141267432) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 3,4-dichloropyridine-2-carboxylate;triethylazanium.
| Compound Name | 3,4-dichloropyridine-2-carboxylate;triethylazanium |
|---|---|
| PubChem CID | 141267432 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3,4-dichloropyridine-2-carboxylate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C([O-])c1nccc(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl2NO2.C6H15N/c7-3-1-2-9-5(4(3)8)6(10)11;1-4-7(5-2)6-3/h1-2H,(H,10,11);4-6H2,1-3H3 |
| InChIKey | GRDOCKBIZNXRBD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |