C13H14Cl2N2O3 — CID 154941489
ethyl (E)-2-(3,4-dichloropyridine-2-carbonyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 154941489) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is ethyl (E)-2-(3,4-dichloropyridine-2-carbonyl)-3-(dimethylamino)prop-2-enoate.
| Compound Name | ethyl (E)-2-(3,4-dichloropyridine-2-carbonyl)-3-(dimethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 154941489 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | ethyl (E)-2-(3,4-dichloropyridine-2-carbonyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/N(C)C)C(=O)c1nccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-4-20-13(19)8(7-17(2)3)12(18)11-10(15)9(14)5-6-16-11/h5-7H,4H2,1-3H3/b8-7+ |
| InChIKey | RYLRKTDSEUGVBT-BQYQJAHWSA-N |
| XLogP | 2.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|