C8H10Cl2N2O3 — CID 175064916
3,4-dichloropyridine-2-carboxylic acid;O-ethylhydroxylamine (PubChem CID 175064916) has the molecular formula C8H10Cl2N2O3 and a molecular weight of 253.08 g/mol. Its IUPAC name is 3,4-dichloropyridine-2-carboxylic acid;O-ethylhydroxylamine.
| Compound Name | 3,4-dichloropyridine-2-carboxylic acid;O-ethylhydroxylamine |
|---|---|
| PubChem CID | 175064916 |
| Molecular Formula | C8H10Cl2N2O3 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 3,4-dichloropyridine-2-carboxylic acid;O-ethylhydroxylamine |
| SMILES | CCON.O=C(O)c1nccc(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl2NO2.C2H7NO/c7-3-1-2-9-5(4(3)8)6(10)11;1-2-4-3/h1-2H,(H,10,11);2-3H2,1H3 |
| InChIKey | LHRXOUFYNCLCEZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|