About 4-chloropyridine-2,3-dicarboxylic acid;hydrate
4-chloropyridine-2,3-dicarboxylic acid;hydrate (PubChem CID 141172424) has the molecular formula C7H6ClNO5
and a molecular weight of 219.58 g/mol. Its IUPAC name is 4-chloropyridine-2,3-dicarboxylic acid;hydrate.
Molecular Properties
| Compound Name | 4-chloropyridine-2,3-dicarboxylic acid;hydrate |
| PubChem CID | 141172424 |
| Molecular Formula | C7H6ClNO5 |
| Molecular Weight | 219.58 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 4-chloropyridine-2,3-dicarboxylic acid;hydrate |
| SMILES | O.O=C(O)c1nccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C7H4ClNO4.H2O/c8-3-1-2-9-5(7(12)13)4(3)6(10)11;/h1-2H,(H,10,11)(H,12,13);1H2 |
| InChIKey | GSWGYHJMMUNQJA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloropyridine-2,3-dicarboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyridine-2,3-dicarboxylic acid;hydrate?
The IUPAC name of 4-chloropyridine-2,3-dicarboxylic acid;hydrate (CID 141172424) is 4-chloropyridine-2,3-dicarboxylic acid;hydrate.
What is the SMILES notation for 4-chloropyridine-2,3-dicarboxylic acid;hydrate?
The canonical SMILES for 4-chloropyridine-2,3-dicarboxylic acid;hydrate is O.O=C(O)c1nccc(Cl)c1C(=O)O.
What is the InChIKey of 4-chloropyridine-2,3-dicarboxylic acid;hydrate?
The InChIKey is GSWGYHJMMUNQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO4.H2O/c8-3-1-2-9-5(7(12)13)4(3)6(10)11;/h1-2H,(H,10,11)(H,12,13);1H2.
What are the key properties of 4-chloropyridine-2,3-dicarboxylic acid;hydrate?
4-chloropyridine-2,3-dicarboxylic acid;hydrate has a molecular weight of 219.58 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyridine-2,3-dicarboxylic acid;hydrate is sourced from PubChem (CID 141172424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).