About palladium;pyrazine-2,3-dicarboxylic acid
palladium;pyrazine-2,3-dicarboxylic acid (PubChem CID 174785540) has the molecular formula C6H4N2O4Pd
and a molecular weight of 274.53 g/mol. Its IUPAC name is palladium;pyrazine-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | palladium;pyrazine-2,3-dicarboxylic acid |
| PubChem CID | 174785540 |
| Molecular Formula | C6H4N2O4Pd |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | palladium;pyrazine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1nccnc1C(=O)O.[Pd] |
| InChI | InChI=1S/C6H4N2O4.Pd/c9-5(10)3-4(6(11)12)8-2-1-7-3;/h1-2H,(H,9,10)(H,11,12); |
| InChIKey | JTICKBPRPLMKTP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze palladium;pyrazine-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;pyrazine-2,3-dicarboxylic acid?
The IUPAC name of palladium;pyrazine-2,3-dicarboxylic acid (CID 174785540) is palladium;pyrazine-2,3-dicarboxylic acid.
What is the SMILES notation for palladium;pyrazine-2,3-dicarboxylic acid?
The canonical SMILES for palladium;pyrazine-2,3-dicarboxylic acid is O=C(O)c1nccnc1C(=O)O.[Pd].
What is the InChIKey of palladium;pyrazine-2,3-dicarboxylic acid?
The InChIKey is JTICKBPRPLMKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.Pd/c9-5(10)3-4(6(11)12)8-2-1-7-3;/h1-2H,(H,9,10)(H,11,12);.
What are the key properties of palladium;pyrazine-2,3-dicarboxylic acid?
palladium;pyrazine-2,3-dicarboxylic acid has a molecular weight of 274.53 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;pyrazine-2,3-dicarboxylic acid is sourced from PubChem (CID 174785540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).