C7H4ClNO4Zn — CID 156700438
4-chloropyridine-2,3-dicarboxylic acid;zinc (PubChem CID 156700438) has the molecular formula C7H4ClNO4Zn and a molecular weight of 266.95 g/mol. Its IUPAC name is 4-chloropyridine-2,3-dicarboxylic acid;zinc.
| Compound Name | 4-chloropyridine-2,3-dicarboxylic acid;zinc |
|---|---|
| PubChem CID | 156700438 |
| Molecular Formula | C7H4ClNO4Zn |
| Molecular Weight | 266.95 g/mol |
| Exact Mass | 264.91 |
| IUPAC Name | 4-chloropyridine-2,3-dicarboxylic acid;zinc |
| SMILES | O=C(O)c1nccc(Cl)c1C(=O)O.[Zn] |
| InChI | InChI=1S/C7H4ClNO4.Zn/c8-3-1-2-9-5(7(12)13)4(3)6(10)11;/h1-2H,(H,10,11)(H,12,13); |
| InChIKey | RHPDCVQVIRKSCR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.95 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|