C8H8Cl2N2O — CID 123182063
3,4-dichloro-N-ethylpyridine-2-carboxamide (PubChem CID 123182063) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 3,4-dichloro-N-ethylpyridine-2-carboxamide.
| Compound Name | 3,4-dichloro-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123182063 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 3,4-dichloro-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1nccc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2N2O/c1-2-11-8(13)7-6(10)5(9)3-4-12-7/h3-4H,2H2,1H3,(H,11,13) |
| InChIKey | HCGMIODHELNLHH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |