C10H11ClN3O3- — CID 21297320
N-[2-[(4-chloro-3-methylpyridine-2-carbonyl)amino]ethyl]carbamate (PubChem CID 21297320) has the molecular formula C10H11ClN3O3- and a molecular weight of 256.67 g/mol. Its IUPAC name is N-[2-[(4-chloro-3-methylpyridine-2-carbonyl)amino]ethyl]carbamate.
| Compound Name | N-[2-[(4-chloro-3-methylpyridine-2-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 21297320 |
| Molecular Formula | C10H11ClN3O3- |
| Molecular Weight | 256.67 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-[2-[(4-chloro-3-methylpyridine-2-carbonyl)amino]ethyl]carbamate |
| SMILES | Cc1c(Cl)ccnc1C(=O)NCCNC(=O)[O-] |
| InChI | InChI=1S/C10H12ClN3O3/c1-6-7(11)2-3-12-8(6)9(15)13-4-5-14-10(16)17/h2-3,14H,4-5H2,1H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | AGJHCDHYUSAHPJ-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.67 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|