C13H10Cl2N3O3S- — CID 19768839
N-[2-[[5-(2,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 19768839) has the molecular formula C13H10Cl2N3O3S- and a molecular weight of 359.21 g/mol. Its IUPAC name is N-[2-[[5-(2,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | N-[2-[[5-(2,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 19768839 |
| Molecular Formula | C13H10Cl2N3O3S- |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | N-[2-[[5-(2,4-dichlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNC(=O)c1ncsc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O3S/c14-7-1-2-8(9(15)5-7)11-10(18-6-22-11)12(19)16-3-4-17-13(20)21/h1-2,5-6,17H,3-4H2,(H,16,19)(H,20,21)/p-1 |
| InChIKey | SNGGRDIBMGHSHZ-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|