C10H11N3OS2 — CID 19768623
N-(2-aminoethyl)-5-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 19768623) has the molecular formula C10H11N3OS2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 19768623 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | N-(2-aminoethyl)-5-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | NCCNC(=O)c1ncsc1-c1cccs1 |
| InChI | InChI=1S/C10H11N3OS2/c11-3-4-12-10(14)8-9(16-6-13-8)7-2-1-5-15-7/h1-2,5-6H,3-4,11H2,(H,12,14) |
| InChIKey | LVGMHSGSUNOYJB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |