C13H11FN3O3S- — CID 19768576
N-[2-[[5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 19768576) has the molecular formula C13H11FN3O3S- and a molecular weight of 308.31 g/mol. Its IUPAC name is N-[2-[[5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | N-[2-[[5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 19768576 |
| Molecular Formula | C13H11FN3O3S- |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-[2-[[5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNC(=O)c1ncsc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN3O3S/c14-9-3-1-8(2-4-9)11-10(17-7-21-11)12(18)15-5-6-16-13(19)20/h1-4,7,16H,5-6H2,(H,15,18)(H,19,20)/p-1 |
| InChIKey | BKDKGERXNUCJFR-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|