C18H23N3O4S — CID 54010314
tert-butyl N-[2-[[5-(3-methoxyphenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 54010314) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(3-methoxyphenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(3-methoxyphenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 54010314 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | tert-butyl N-[2-[[5-(3-methoxyphenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | COc1cccc(-c2scnc2C(=O)NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-18(2,3)25-17(23)20-9-8-19-16(22)14-15(26-11-21-14)12-6-5-7-13(10-12)24-4/h5-7,10-11H,8-9H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | KRWLEMACNLRQHB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|