C21H28N2O4 — CID 176580229
tert-butyl N-[2-acetyl-5-(3-methoxyphenyl)-3-pyridinyl]carbamate;ethane (PubChem CID 176580229) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl N-[2-acetyl-5-(3-methoxyphenyl)-3-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-acetyl-5-(3-methoxyphenyl)-3-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 176580229 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl N-[2-acetyl-5-(3-methoxyphenyl)-3-pyridinyl]carbamate;ethane |
| SMILES | CC.COc1cccc(-c2cnc(C(C)=O)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C19H22N2O4.C2H6/c1-12(22)17-16(21-18(23)25-19(2,3)4)10-14(11-20-17)13-7-6-8-15(9-13)24-5;1-2/h6-11H,1-5H3,(H,21,23);1-2H3 |
| InChIKey | VVSHAUMORBKTKP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |