C23H32N4O4 — CID 176581654
tert-butyl N-[2-[2-(2-aminoethoxy)ethylcarbamoyl]-5-(3-ethylphenyl)-3-pyridinyl]carbamate (PubChem CID 176581654) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-aminoethoxy)ethylcarbamoyl]-5-(3-ethylphenyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethylcarbamoyl]-5-(3-ethylphenyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 176581654 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethylcarbamoyl]-5-(3-ethylphenyl)-3-pyridinyl]carbamate |
| SMILES | CCc1cccc(-c2cnc(C(=O)NCCOCCN)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C23H32N4O4/c1-5-16-7-6-8-17(13-16)18-14-19(27-22(29)31-23(2,3)4)20(26-15-18)21(28)25-10-12-30-11-9-24/h6-8,13-15H,5,9-12,24H2,1-4H3,(H,25,28)(H,27,29) |
| InChIKey | WOOUXKAELHYAFM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|