C37H40N4O5 — CID 176577853
9H-fluoren-9-ylmethyl N-[2-[2-[[3-acetamido-5-(3-ethylphenyl)pyridine-2-carbonyl]amino]ethoxy]ethyl]-N-ethylcarbamate (PubChem CID 176577853) has the molecular formula C37H40N4O5 and a molecular weight of 620.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2-[[3-acetamido-5-(3-ethylphenyl)pyridine-2-carbonyl]amino]ethoxy]ethyl]-N-ethylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2-[[3-acetamido-5-(3-ethylphenyl)pyridine-2-carbonyl]amino]ethoxy]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 176577853 |
| Molecular Formula | C37H40N4O5 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2-[[3-acetamido-5-(3-ethylphenyl)pyridine-2-carbonyl]amino]ethoxy]ethyl]-N-ethylcarbamate |
| SMILES | CCc1cccc(-c2cnc(C(=O)NCCOCCN(CC)C(=O)OCC3c4ccccc4-c4ccccc43)c(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C37H40N4O5/c1-4-26-11-10-12-27(21-26)28-22-34(40-25(3)42)35(39-23-28)36(43)38-17-19-45-20-18-41(5-2)37(44)46-24-33-31-15-8-6-13-29(31)30-14-7-9-16-32(30)33/h6-16,21-23,33H,4-5,17-20,24H2,1-3H3,(H,38,43)(H,40,42) |
| InChIKey | FAYBKGJMSDRDCL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|