C18H22N2O3 — CID 176581887
3-acetamido-5-(3-ethylphenyl)pyridine-2-carboxylic acid;ethane (PubChem CID 176581887) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-acetamido-5-(3-ethylphenyl)pyridine-2-carboxylic acid;ethane.
| Compound Name | 3-acetamido-5-(3-ethylphenyl)pyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 176581887 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-acetamido-5-(3-ethylphenyl)pyridine-2-carboxylic acid;ethane |
| SMILES | CC.CCc1cccc(-c2cnc(C(=O)O)c(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C16H16N2O3.C2H6/c1-3-11-5-4-6-12(7-11)13-8-14(18-10(2)19)15(16(20)21)17-9-13;1-2/h4-9H,3H2,1-2H3,(H,18,19)(H,20,21);1-2H3 |
| InChIKey | DDWWPBBVQZYONS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |