C19H26N2O3 — CID 176575953
acetaldehyde;ethane;5-(3-ethylphenyl)-3-(methylamino)pyridine-2-carboxylic acid (PubChem CID 176575953) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is acetaldehyde;ethane;5-(3-ethylphenyl)-3-(methylamino)pyridine-2-carboxylic acid.
| Compound Name | acetaldehyde;ethane;5-(3-ethylphenyl)-3-(methylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 176575953 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | acetaldehyde;ethane;5-(3-ethylphenyl)-3-(methylamino)pyridine-2-carboxylic acid |
| SMILES | CC.CC=O.CCc1cccc(-c2cnc(C(=O)O)c(NC)c2)c1 |
| InChI | InChI=1S/C15H16N2O2.C2H4O.C2H6/c1-3-10-5-4-6-11(7-10)12-8-13(16-2)14(15(18)19)17-9-12;1-2-3;1-2/h4-9,16H,3H2,1-2H3,(H,18,19);2H,1H3;1-2H3 |
| InChIKey | RQVDXFRCOAFDIU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|