C21H27N3O4 — CID 176581566
5-(3-ethylphenyl)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-2-carboxylic acid (PubChem CID 176581566) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-(3-ethylphenyl)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-(3-ethylphenyl)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 176581566 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-(3-ethylphenyl)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-2-carboxylic acid |
| SMILES | CCc1cccc(-c2cnc(C(=O)O)c(NCCNC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-5-14-7-6-8-15(11-14)16-12-17(18(19(25)26)24-13-16)22-9-10-23-20(27)28-21(2,3)4/h6-8,11-13,22H,5,9-10H2,1-4H3,(H,23,27)(H,25,26) |
| InChIKey | FMHWLSSWIZABEL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|