C23H25N5O2 — CID 176581913
5-(3-ethylphenyl)-2-propanoyl-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide (PubChem CID 176581913) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-(3-ethylphenyl)-2-propanoyl-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-(3-ethylphenyl)-2-propanoyl-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 176581913 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-(3-ethylphenyl)-2-propanoyl-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide |
| SMILES | CCC(=O)c1ncc(-c2cccc(CC)c2)cc1C(=O)NCCNc1ccncn1 |
| InChI | InChI=1S/C23H25N5O2/c1-3-16-6-5-7-17(12-16)18-13-19(22(27-14-18)20(29)4-2)23(30)26-11-10-25-21-8-9-24-15-28-21/h5-9,12-15H,3-4,10-11H2,1-2H3,(H,26,30)(H,24,25,28) |
| InChIKey | GQJJOWSYTRKWJU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|