About ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen
ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen (PubChem CID 176579358) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen |
| PubChem CID | 176579358 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen |
| SMILES | CC.CCc1cccc(-c2cnc(C(=O)OC)c(C)c2)c1.[H][H] |
| InChI | InChI=1S/C16H17NO2.C2H6.H2/c1-4-12-6-5-7-13(9-12)14-8-11(2)15(17-10-14)16(18)19-3;1-2;/h5-10H,4H2,1-3H3;1-2H3;1H |
| InChIKey | YHAIZROQGFNLKL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen?
The IUPAC name of ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen (CID 176579358) is ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen.
What is the SMILES notation for ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen?
The canonical SMILES for ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen is CC.CCc1cccc(-c2cnc(C(=O)OC)c(C)c2)c1.[H][H].
What is the InChIKey of ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen?
The InChIKey is YHAIZROQGFNLKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2.C2H6.H2/c1-4-12-6-5-7-13(9-12)14-8-11(2)15(17-10-14)16(18)19-3;1-2;/h5-10H,4H2,1-3H3;1-2H3;1H.
What are the key properties of ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen?
ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen has a molecular weight of 287.40 g/mol, XLogP of 4.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 5-(3-ethylphenyl)-3-methylpyridine-2-carboxylate;molecular hydrogen is sourced from PubChem (CID 176579358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).