C25H31N5O2 — CID 176581245
5-(3-ethylphenyl)-2-[(2S)-2-methylbutanoyl]-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide;molecular hydrogen (PubChem CID 176581245) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 5-(3-ethylphenyl)-2-[(2S)-2-methylbutanoyl]-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide;molecular hydrogen.
| Compound Name | 5-(3-ethylphenyl)-2-[(2S)-2-methylbutanoyl]-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 176581245 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 5-(3-ethylphenyl)-2-[(2S)-2-methylbutanoyl]-N-[2-(pyrimidin-4-ylamino)ethyl]pyridine-3-carboxamide;molecular hydrogen |
| SMILES | CCc1cccc(-c2cnc(C(=O)[C@@H](C)CC)c(C(=O)NCCNc3ccncn3)c2)c1.[H][H] |
| InChI | InChI=1S/C25H29N5O2.H2/c1-4-17(3)24(31)23-21(25(32)28-12-11-27-22-9-10-26-16-30-22)14-20(15-29-23)19-8-6-7-18(5-2)13-19;/h6-10,13-17H,4-5,11-12H2,1-3H3,(H,28,32)(H,26,27,30);1H/t17-;/m0./s1 |
| InChIKey | PHLPMXLWFXTUJA-LMOVPXPDSA-N |
| XLogP | 4.42 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|