C22H28N2O2 — CID 176578205
1-[3-[(3-ethyloxetan-3-yl)amino]-5-(3-ethylphenyl)-2-pyridinyl]-2-methylpropan-1-one (PubChem CID 176578205) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[3-[(3-ethyloxetan-3-yl)amino]-5-(3-ethylphenyl)-2-pyridinyl]-2-methylpropan-1-one.
| Compound Name | 1-[3-[(3-ethyloxetan-3-yl)amino]-5-(3-ethylphenyl)-2-pyridinyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 176578205 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[3-[(3-ethyloxetan-3-yl)amino]-5-(3-ethylphenyl)-2-pyridinyl]-2-methylpropan-1-one |
| SMILES | CCc1cccc(-c2cnc(C(=O)C(C)C)c(NC3(CC)COC3)c2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-16-8-7-9-17(10-16)18-11-19(24-22(6-2)13-26-14-22)20(23-12-18)21(25)15(3)4/h7-12,15,24H,5-6,13-14H2,1-4H3 |
| InChIKey | VLQIZGOBBJTYFE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |