C7H11N5O — CID 83113277
2-(pyrimidin-4-ylamino)ethylurea (PubChem CID 83113277) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-(pyrimidin-4-ylamino)ethylurea.
| Compound Name | 2-(pyrimidin-4-ylamino)ethylurea |
|---|---|
| PubChem CID | 83113277 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-(pyrimidin-4-ylamino)ethylurea |
| SMILES | NC(=O)NCCNc1ccncn1 |
| InChI | InChI=1S/C7H11N5O/c8-7(13)11-4-3-10-6-1-2-9-5-12-6/h1-2,5H,3-4H2,(H3,8,11,13)(H,9,10,12) |
| InChIKey | FJHHOQADTRHOJX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|