C9H11N5O — CID 83092415
2-[(4-cyano-3-pyridinyl)amino]ethylurea (PubChem CID 83092415) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-[(4-cyano-3-pyridinyl)amino]ethylurea.
| Compound Name | 2-[(4-cyano-3-pyridinyl)amino]ethylurea |
|---|---|
| PubChem CID | 83092415 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-[(4-cyano-3-pyridinyl)amino]ethylurea |
| SMILES | N#Cc1ccncc1NCCNC(N)=O |
| InChI | InChI=1S/C9H11N5O/c10-5-7-1-2-12-6-8(7)13-3-4-14-9(11)15/h1-2,6,13H,3-4H2,(H3,11,14,15) |
| InChIKey | HMRZHZXETHYXGU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|