C17H20IN3O3S — CID 54091391
tert-butyl N-[2-[[5-(3-iodophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 54091391) has the molecular formula C17H20IN3O3S and a molecular weight of 473.34 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(3-iodophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(3-iodophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 54091391 |
| Molecular Formula | C17H20IN3O3S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | tert-butyl N-[2-[[5-(3-iodophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ncsc1-c1cccc(I)c1 |
| InChI | InChI=1S/C17H20IN3O3S/c1-17(2,3)24-16(23)20-8-7-19-15(22)13-14(25-10-21-13)11-5-4-6-12(18)9-11/h4-6,9-10H,7-8H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | MUCMGYCHMWGPSM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|