C8H10N3O4- — CID 21297353
N-[2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate (PubChem CID 21297353) has the molecular formula C8H10N3O4- and a molecular weight of 212.18 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate.
| Compound Name | N-[2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 21297353 |
| Molecular Formula | C8H10N3O4- |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-[2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate |
| SMILES | Cc1cc(C(=O)NCCNC(=O)[O-])no1 |
| InChI | InChI=1S/C8H11N3O4/c1-5-4-6(11-15-5)7(12)9-2-3-10-8(13)14/h4,10H,2-3H2,1H3,(H,9,12)(H,13,14)/p-1 |
| InChIKey | UQHRATYIFGVPKS-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|