C11H19N3O2 — CID 143192635
N-(6-aminohexyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 143192635) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(6-aminohexyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(6-aminohexyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 143192635 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(6-aminohexyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCCCN)no1 |
| InChI | InChI=1S/C11H19N3O2/c1-9-8-10(14-16-9)11(15)13-7-5-3-2-4-6-12/h8H,2-7,12H2,1H3,(H,13,15) |
| InChIKey | CQCLTTZMLPWEFI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|