C11H12N2O3 — CID 71798432
N-[2-(furan-3-yl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 71798432) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[2-(furan-3-yl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(furan-3-yl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 71798432 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[2-(furan-3-yl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2ccoc2)no1 |
| InChI | InChI=1S/C11H12N2O3/c1-8-6-10(13-16-8)11(14)12-4-2-9-3-5-15-7-9/h3,5-7H,2,4H2,1H3,(H,12,14) |
| InChIKey | MQMPZMCSPZRULL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |