C9H13NO3 — CID 90558235
N-[2-(furan-3-yl)ethyl]-2-methoxyacetamide (PubChem CID 90558235) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-[2-(furan-3-yl)ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-(furan-3-yl)ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 90558235 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-[2-(furan-3-yl)ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCc1ccoc1 |
| InChI | InChI=1S/C9H13NO3/c1-12-7-9(11)10-4-2-8-3-5-13-6-8/h3,5-6H,2,4,7H2,1H3,(H,10,11) |
| InChIKey | YSLHIQHESRCNAH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |