C10H13ClN2O2 — CID 88953829
N-[2-(2-chloro-4-pyridinyl)ethyl]-2-methoxyacetamide (PubChem CID 88953829) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is N-[2-(2-chloro-4-pyridinyl)ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-(2-chloro-4-pyridinyl)ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 88953829 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-[2-(2-chloro-4-pyridinyl)ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-15-7-10(14)13-5-3-8-2-4-12-9(11)6-8/h2,4,6H,3,5,7H2,1H3,(H,13,14) |
| InChIKey | DSUAIKSKNALHES-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|