C19H25NO5 — CID 90558366
3,4,5-triethoxy-N-[2-(furan-3-yl)ethyl]benzamide (PubChem CID 90558366) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(furan-3-yl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(furan-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90558366 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(furan-3-yl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCc2ccoc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H25NO5/c1-4-23-16-11-15(12-17(24-5-2)18(16)25-6-3)19(21)20-9-7-14-8-10-22-13-14/h8,10-13H,4-7,9H2,1-3H3,(H,20,21) |
| InChIKey | FYSCOKLVJRLEPO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |