C15H15ClN4O2 — CID 47049468
N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 47049468) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47049468 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nccc(C(=O)NCCNC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H15ClN4O2/c1-10-17-7-6-13(20-10)15(22)19-9-8-18-14(21)11-4-2-3-5-12(11)16/h2-7H,8-9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | WUOKUJFBVWWKMY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|