C16H19ClN4O2S — CID 74234317
N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 74234317) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 74234317 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)Cc1nc(C(=O)NCCNC(=O)c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C16H19ClN4O2S/c1-21(2)9-14-20-13(10-24-14)16(23)19-8-7-18-15(22)11-5-3-4-6-12(11)17/h3-6,10H,7-9H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | TXNXFNGESNWLTR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|