C21H20FN3O4S — CID 46106073
N-[2-[(2-fluorobenzoyl)amino]ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 46106073) has the molecular formula C21H20FN3O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[2-[(2-fluorobenzoyl)amino]ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46106073 |
| Molecular Formula | C21H20FN3O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccccc1OCc1nc(C(=O)NCCNC(=O)c2ccccc2F)cs1 |
| InChI | InChI=1S/C21H20FN3O4S/c1-28-17-8-4-5-9-18(17)29-12-19-25-16(13-30-19)21(27)24-11-10-23-20(26)14-6-2-3-7-15(14)22/h2-9,13H,10-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | XRKPYSLLMGPDOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|