C14H15FN2O3S — CID 24712829
2-[(4-fluorophenoxy)methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 24712829) has the molecular formula C14H15FN2O3S and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24712829 |
| Molecular Formula | C14H15FN2O3S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15FN2O3S/c1-19-7-6-16-14(18)12-9-21-13(17-12)8-20-11-4-2-10(15)3-5-11/h2-5,9H,6-8H2,1H3,(H,16,18) |
| InChIKey | MRHZQZFZYOFXQN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|