C20H18F2N2O3S — CID 46065850
2-[4-[(3,4-difluorophenyl)methoxy]phenyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 46065850) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-[4-[(3,4-difluorophenyl)methoxy]phenyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-[(3,4-difluorophenyl)methoxy]phenyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46065850 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[4-[(3,4-difluorophenyl)methoxy]phenyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1csc(-c2ccc(OCc3ccc(F)c(F)c3)cc2)n1 |
| InChI | InChI=1S/C20H18F2N2O3S/c1-26-9-8-23-19(25)18-12-28-20(24-18)14-3-5-15(6-4-14)27-11-13-2-7-16(21)17(22)10-13/h2-7,10,12H,8-9,11H2,1H3,(H,23,25) |
| InChIKey | KLLDJPGMPQIBTB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|