C12H11FN2O3S — CID 33104782
2-[(4-fluorophenoxy)methyl]-N-methoxy-1,3-thiazole-4-carboxamide (PubChem CID 33104782) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-N-methoxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-N-methoxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 33104782 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-N-methoxy-1,3-thiazole-4-carboxamide |
| SMILES | CONC(=O)c1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H11FN2O3S/c1-17-15-12(16)10-7-19-11(14-10)6-18-9-4-2-8(13)3-5-9/h2-5,7H,6H2,1H3,(H,15,16) |
| InChIKey | HRONUTVVJZAPCP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|