C21H20FN3O3S — CID 46105843
N-[2-[(3-fluorobenzoyl)amino]ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 46105843) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[2-[(3-fluorobenzoyl)amino]ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(3-fluorobenzoyl)amino]ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46105843 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[2-[(3-fluorobenzoyl)amino]ethyl]-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(OCc2nc(C(=O)NCCNC(=O)c3cccc(F)c3)cs2)cc1 |
| InChI | InChI=1S/C21H20FN3O3S/c1-14-5-7-17(8-6-14)28-12-19-25-18(13-29-19)21(27)24-10-9-23-20(26)15-3-2-4-16(22)11-15/h2-8,11,13H,9-10,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | CVCTZRHSVULECK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|