C20H16Cl2FN3O3S — CID 46106176
N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 46106176) has the molecular formula C20H16Cl2FN3O3S and a molecular weight of 468.34 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46106176 |
| Molecular Formula | C20H16Cl2FN3O3S |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCNC(=O)c1csc(COc2ccccc2F)n1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2FN3O3S/c21-13-6-5-12(9-14(13)22)19(27)24-7-8-25-20(28)16-11-30-18(26-16)10-29-17-4-2-1-3-15(17)23/h1-6,9,11H,7-8,10H2,(H,24,27)(H,25,28) |
| InChIKey | XRUAZKFCNMNJKP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|