C20H17ClN2O4S — CID 44764331
[4-[2-(2-chlorophenoxy)ethylcarbamoyl]-1,3-thiazol-2-yl]methyl benzoate (PubChem CID 44764331) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is [4-[2-(2-chlorophenoxy)ethylcarbamoyl]-1,3-thiazol-2-yl]methyl benzoate.
| Compound Name | [4-[2-(2-chlorophenoxy)ethylcarbamoyl]-1,3-thiazol-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 44764331 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | [4-[2-(2-chlorophenoxy)ethylcarbamoyl]-1,3-thiazol-2-yl]methyl benzoate |
| SMILES | O=C(OCc1nc(C(=O)NCCOc2ccccc2Cl)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O4S/c21-15-8-4-5-9-17(15)26-11-10-22-19(24)16-13-28-18(23-16)12-27-20(25)14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,22,24) |
| InChIKey | UZTOSKFBUWRINP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|