C17H16N4O2S — CID 87031750
N-[2-(2-methylphenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 87031750) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[2-(2-methylphenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-methylphenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 87031750 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-(2-methylphenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)c1csc(-c2ncccn2)n1 |
| InChI | InChI=1S/C17H16N4O2S/c1-12-5-2-3-6-14(12)23-10-9-20-16(22)13-11-24-17(21-13)15-18-7-4-8-19-15/h2-8,11H,9-10H2,1H3,(H,20,22) |
| InChIKey | LSCAIQFGCXXMHZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|