C24H26N2O4S — CID 2227968
2-N,5-N-bis[2-(2-methylphenoxy)ethyl]thiophene-2,5-dicarboxamide (PubChem CID 2227968) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-N,5-N-bis[2-(2-methylphenoxy)ethyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[2-(2-methylphenoxy)ethyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 2227968 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-N,5-N-bis[2-(2-methylphenoxy)ethyl]thiophene-2,5-dicarboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)c1ccc(C(=O)NCCOc2ccccc2C)s1 |
| InChI | InChI=1S/C24H26N2O4S/c1-17-7-3-5-9-19(17)29-15-13-25-23(27)21-11-12-22(31-21)24(28)26-14-16-30-20-10-6-4-8-18(20)2/h3-12H,13-16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GELVOXWQBICXPJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|