C21H17F4N3O3S — CID 46106194
2-[(2-fluorophenoxy)methyl]-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 46106194) has the molecular formula C21H17F4N3O3S and a molecular weight of 467.44 g/mol. Its IUPAC name is 2-[(2-fluorophenoxy)methyl]-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2-fluorophenoxy)methyl]-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46106194 |
| Molecular Formula | C21H17F4N3O3S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-[(2-fluorophenoxy)methyl]-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCNC(=O)c1csc(COc2ccccc2F)n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F4N3O3S/c22-15-3-1-2-4-17(15)31-11-18-28-16(12-32-18)20(30)27-10-9-26-19(29)13-5-7-14(8-6-13)21(23,24)25/h1-8,12H,9-11H2,(H,26,29)(H,27,30) |
| InChIKey | FVTBAWPNNFECPZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|