C29H29N3O3S — CID 46105916
2-[(3,5-dimethylphenoxy)methyl]-N-[2-[(2,2-diphenylacetyl)amino]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 46105916) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenoxy)methyl]-N-[2-[(2,2-diphenylacetyl)amino]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[2-[(2,2-diphenylacetyl)amino]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46105916 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[2-[(2,2-diphenylacetyl)amino]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(OCc2nc(C(=O)NCCNC(=O)C(c3ccccc3)c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C29H29N3O3S/c1-20-15-21(2)17-24(16-20)35-18-26-32-25(19-36-26)28(33)30-13-14-31-29(34)27(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-12,15-17,19,27H,13-14,18H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | SCRSRQDHJROOFI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|