C23H25N5O5S — CID 46171699
2-[(3,5-dimethylphenoxy)methyl]-N-[3-[(4-nitrophenyl)carbamoylamino]propyl]-1,3-thiazole-4-carboxamide (PubChem CID 46171699) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenoxy)methyl]-N-[3-[(4-nitrophenyl)carbamoylamino]propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[3-[(4-nitrophenyl)carbamoylamino]propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46171699 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[3-[(4-nitrophenyl)carbamoylamino]propyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(OCc2nc(C(=O)NCCCNC(=O)Nc3ccc([N+](=O)[O-])cc3)cs2)c1 |
| InChI | InChI=1S/C23H25N5O5S/c1-15-10-16(2)12-19(11-15)33-13-21-27-20(14-34-21)22(29)24-8-3-9-25-23(30)26-17-4-6-18(7-5-17)28(31)32/h4-7,10-12,14H,3,8-9,13H2,1-2H3,(H,24,29)(H2,25,26,30) |
| InChIKey | CJSSYOLQNPJHAV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|