C24H25N3O3S — CID 71958162
2-[(3,5-dimethylphenoxy)methyl]-N-[2-(3-phenylprop-2-enoylamino)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 71958162) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenoxy)methyl]-N-[2-(3-phenylprop-2-enoylamino)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[2-(3-phenylprop-2-enoylamino)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71958162 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[(3,5-dimethylphenoxy)methyl]-N-[2-(3-phenylprop-2-enoylamino)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(C)cc(OCc2nc(C(=O)NCCNC(=O)C=Cc3ccccc3)cs2)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-17-12-18(2)14-20(13-17)30-15-23-27-21(16-31-23)24(29)26-11-10-25-22(28)9-8-19-6-4-3-5-7-19/h3-9,12-14,16H,10-11,15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | ITHYXESRSGPZGG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|