C20H25Cl2N3O2S — CID 4587471
N-butyl-2-[[butyl-(2,4-dichlorobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 4587471) has the molecular formula C20H25Cl2N3O2S and a molecular weight of 442.41 g/mol. Its IUPAC name is N-butyl-2-[[butyl-(2,4-dichlorobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[butyl-(2,4-dichlorobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4587471 |
| Molecular Formula | C20H25Cl2N3O2S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-butyl-2-[[butyl-(2,4-dichlorobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCCC)C(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H25Cl2N3O2S/c1-3-5-9-23-19(26)17-13-28-18(24-17)12-25(10-6-4-2)20(27)15-8-7-14(21)11-16(15)22/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,23,26) |
| InChIKey | BGWCGQCQKXERHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|