C31H34ClN3OS — CID 3924207
N-butyl-2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 3924207) has the molecular formula C31H34ClN3OS and a molecular weight of 532.15 g/mol. Its IUPAC name is N-butyl-2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3924207 |
| Molecular Formula | C31H34ClN3OS |
| Molecular Weight | 532.15 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-butyl-2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(CCC(c2ccccc2)c2ccccc2)Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C31H34ClN3OS/c1-2-3-19-33-31(36)29-23-37-30(34-29)22-35(21-24-14-16-27(32)17-15-24)20-18-28(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-17,23,28H,2-3,18-22H2,1H3,(H,33,36) |
| InChIKey | CNODUIFLGUGBIZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.15 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|