C32H36ClN3OS — CID 42780781
2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 42780781) has the molecular formula C32H36ClN3OS and a molecular weight of 546.18 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42780781 |
| Molecular Formula | C32H36ClN3OS |
| Molecular Weight | 546.18 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 2-[[(4-chlorophenyl)methyl-(3,3-diphenylpropyl)amino]methyl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(CN(CCC(c2ccccc2)c2ccccc2)Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C32H36ClN3OS/c1-2-3-10-20-34-32(37)30-24-38-31(35-30)23-36(22-25-15-17-28(33)18-16-25)21-19-29(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-18,24,29H,2-3,10,19-23H2,1H3,(H,34,37) |
| InChIKey | KRUDDPWTACYZBU-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.18 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|