C30H32FN3O2S — CID 42665364
N-butyl-2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 42665364) has the molecular formula C30H32FN3O2S and a molecular weight of 517.67 g/mol. Its IUPAC name is N-butyl-2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42665364 |
| Molecular Formula | C30H32FN3O2S |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-butyl-2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CN(Cc2ccc(F)cc2)Cc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C30H32FN3O2S/c1-2-3-17-32-30(35)28-22-37-29(33-28)20-34(18-23-9-13-26(31)14-10-23)19-24-11-15-27(16-12-24)36-21-25-7-5-4-6-8-25/h4-16,22H,2-3,17-21H2,1H3,(H,32,35) |
| InChIKey | WWJDNMJQVURBAM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|